C30H35N5O — CID 126681702
2-[3-(aminomethyl)phenyl]-5-methyl-N-[3-[(pentylamino)-phenylmethyl]phenyl]pyrazole-3-carboxamide (PubChem CID 126681702) has the molecular formula C30H35N5O and a molecular weight of 481.64 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-5-methyl-N-[3-[(pentylamino)-phenylmethyl]phenyl]pyrazole-3-carboxamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]-5-methyl-N-[3-[(pentylamino)-phenylmethyl]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126681702 |
| Molecular Formula | C30H35N5O |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-5-methyl-N-[3-[(pentylamino)-phenylmethyl]phenyl]pyrazole-3-carboxamide |
| SMILES | CCCCCNC(c1ccccc1)c1cccc(NC(=O)c2cc(C)nn2-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C30H35N5O/c1-3-4-8-17-32-29(24-12-6-5-7-13-24)25-14-10-15-26(20-25)33-30(36)28-18-22(2)34-35(28)27-16-9-11-23(19-27)21-31/h5-7,9-16,18-20,29,32H,3-4,8,17,21,31H2,1-2H3,(H,33,36) |
| InChIKey | UYUOYOWXOOUFCV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|