C29H31N5O3 — CID 126665468
2-[3-(aminomethyl)phenyl]-N-[3-[[cyclopropyl(methyl)amino]-(2,3-dihydroxyphenyl)methyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 126665468) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-N-[3-[[cyclopropyl(methyl)amino]-(2,3-dihydroxyphenyl)methyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]-N-[3-[[cyclopropyl(methyl)amino]-(2,3-dihydroxyphenyl)methyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126665468 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-N-[3-[[cyclopropyl(methyl)amino]-(2,3-dihydroxyphenyl)methyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(c3cccc(O)c3O)N(C)C3CC3)c2)n(-c2cccc(CN)c2)n1 |
| InChI | InChI=1S/C29H31N5O3/c1-18-14-25(34(32-18)23-9-3-6-19(15-23)17-30)29(37)31-21-8-4-7-20(16-21)27(33(2)22-12-13-22)24-10-5-11-26(35)28(24)36/h3-11,14-16,22,27,35-36H,12-13,17,30H2,1-2H3,(H,31,37) |
| InChIKey | RPHMJYDROUMPOP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|