C35H22N6 — CID 126682827
15-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-4,6,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 126682827) has the molecular formula C35H22N6 and a molecular weight of 526.60 g/mol. Its IUPAC name is 15-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-4,6,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 15-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-4,6,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 126682827 |
| Molecular Formula | C35H22N6 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 15-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-4,6,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc4c5c(cccc5c3)N(c3ccccc3)c3ncncc3-4)n2)cc1 |
| InChI | InChI=1S/C35H22N6/c1-4-11-23(12-5-1)32-38-33(24-13-6-2-7-14-24)40-34(39-32)26-19-25-15-10-18-30-31(25)28(20-26)29-21-36-22-37-35(29)41(30)27-16-8-3-9-17-27/h1-22H |
| InChIKey | WKLLNCWRGWRLNK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 67.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |