C37H24N4 — CID 126682905
8-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-4,8-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene (PubChem CID 126682905) has the molecular formula C37H24N4 and a molecular weight of 524.63 g/mol. Its IUPAC name is 8-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-4,8-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene.
| Compound Name | 8-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-4,8-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene |
|---|---|
| PubChem CID | 126682905 |
| Molecular Formula | C37H24N4 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 8-(4,6-diphenylpyrimidin-2-yl)-15-phenyl-4,8-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene |
| SMILES | c1ccc(-c2cc3c4c(cccc4c2)N(c2nc(-c4ccccc4)cc(-c4ccccc4)n2)c2ccncc2-3)cc1 |
| InChI | InChI=1S/C37H24N4/c1-4-11-25(12-5-1)29-21-28-17-10-18-35-36(28)30(22-29)31-24-38-20-19-34(31)41(35)37-39-32(26-13-6-2-7-14-26)23-33(40-37)27-15-8-3-9-16-27/h1-24H |
| InChIKey | OKQNXNHTWLFQCM-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |