C64H42N10 — CID 154597654
5-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine (PubChem CID 154597654) has the molecular formula C64H42N10 and a molecular weight of 951.11 g/mol. Its IUPAC name is 5-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine.
| Compound Name | 5-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
|---|---|
| PubChem CID | 154597654 |
| Molecular Formula | C64H42N10 |
| Molecular Weight | 951.11 g/mol |
| Exact Mass | 950.36 |
| IUPAC Name | 5-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
| SMILES | c1ccc(-c2cc(-c3ccc(N4c5ccccc5N(c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5ccccc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C64H42N10/c1-7-23-43(24-8-1)51-42-52(66-58(65-51)44-25-9-2-10-26-44)49-39-40-53(50(41-49)63-69-59(45-27-11-3-12-28-45)67-60(70-63)46-29-13-4-14-30-46)73-54-35-19-21-37-56(54)74(57-38-22-20-36-55(57)73)64-71-61(47-31-15-5-16-32-47)68-62(72-64)48-33-17-6-18-34-48/h1-42H |
| InChIKey | LAHJGPWDSHIACK-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.11 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |