C64H40N12 — CID 154597734
5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenazine (PubChem CID 154597734) has the molecular formula C64H40N12 and a molecular weight of 977.11 g/mol. Its IUPAC name is 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenazine.
| Compound Name | 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenazine |
|---|---|
| PubChem CID | 154597734 |
| Molecular Formula | C64H40N12 |
| Molecular Weight | 977.11 g/mol |
| Exact Mass | 976.35 |
| IUPAC Name | 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-isocyanophenazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(c1nc(-c3ccccc3)nc(-c3ccccc3)n1)c1ccccc1N2c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C64H40N12/c1-65-49-37-39-54-55(41-49)76(64-73-60(46-30-16-6-17-31-46)70-61(74-64)47-32-18-7-19-33-47)53-35-21-20-34-52(53)75(54)51-38-36-48(62-68-56(42-22-8-2-9-23-42)66-57(69-62)43-24-10-3-11-25-43)40-50(51)63-71-58(44-26-12-4-13-27-44)67-59(72-63)45-28-14-5-15-29-45/h2-41H |
| InChIKey | ORVINFJLKGSGCH-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 126.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.11 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|