C55H35N7 — CID 176848004
2-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanophenyl)phenyl]-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176848004) has the molecular formula C55H35N7 and a molecular weight of 793.93 g/mol. Its IUPAC name is 2-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanophenyl)phenyl]-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanophenyl)phenyl]-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176848004 |
| Molecular Formula | C55H35N7 |
| Molecular Weight | 793.93 g/mol |
| Exact Mass | 793.30 |
| IUPAC Name | 2-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanophenyl)phenyl]-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-c3ccc(-c4ccccc4)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C55H35N7/c1-56-45-29-17-28-42(34-45)44-31-33-47(54-59-50(38-20-9-3-10-21-38)57-51(60-54)39-22-11-4-12-23-39)48(35-44)46-32-30-43(37-18-7-2-8-19-37)36-49(46)55-61-52(40-24-13-5-14-25-40)58-53(62-55)41-26-15-6-16-27-41/h2-36H |
| InChIKey | OUFIVEPGPSJXJI-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.93 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|