C38H24N4 — CID 158503468
2-[2-[4-(3-isocyanophenyl)phenyl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 158503468) has the molecular formula C38H24N4 and a molecular weight of 536.64 g/mol. Its IUPAC name is 2-[2-[4-(3-isocyanophenyl)phenyl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-[4-(3-isocyanophenyl)phenyl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 158503468 |
| Molecular Formula | C38H24N4 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[2-[4-(3-isocyanophenyl)phenyl]naphthalen-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(-c3ccc4ccccc4c3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c1 |
| InChI | InChI=1S/C38H24N4/c1-39-32-17-10-16-31(25-32)26-19-21-28(22-20-26)34-24-23-27-11-8-9-18-33(27)35(34)38-41-36(29-12-4-2-5-13-29)40-37(42-38)30-14-6-3-7-15-30/h2-25H |
| InChIKey | PQVMMOYJXYIVES-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|