C48H30N6 — CID 176848086
4-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(4-isocyanophenyl)phenyl]phenyl]-2-phenylquinazoline (PubChem CID 176848086) has the molecular formula C48H30N6 and a molecular weight of 690.81 g/mol. Its IUPAC name is 4-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(4-isocyanophenyl)phenyl]phenyl]-2-phenylquinazoline.
| Compound Name | 4-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(4-isocyanophenyl)phenyl]phenyl]-2-phenylquinazoline |
|---|---|
| PubChem CID | 176848086 |
| Molecular Formula | C48H30N6 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 4-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(4-isocyanophenyl)phenyl]phenyl]-2-phenylquinazoline |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3ccccc3-c3nc(-c4ccccc4)nc4ccccc34)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C48H30N6/c1-49-37-28-25-32(26-29-37)36-27-30-39(42(31-36)48-53-46(34-17-7-3-8-18-34)52-47(54-48)35-19-9-4-10-20-35)38-21-11-12-22-40(38)44-41-23-13-14-24-43(41)50-45(51-44)33-15-5-2-6-16-33/h2-31H |
| InChIKey | XEDIUBRWEZBATN-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 68.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|