C37H23N3 — CID 162490367
2-[4-[4-(4-isocyanophenyl)phenyl]phenyl]-4-naphthalen-1-ylquinazoline (PubChem CID 162490367) has the molecular formula C37H23N3 and a molecular weight of 509.61 g/mol. Its IUPAC name is 2-[4-[4-(4-isocyanophenyl)phenyl]phenyl]-4-naphthalen-1-ylquinazoline.
| Compound Name | 2-[4-[4-(4-isocyanophenyl)phenyl]phenyl]-4-naphthalen-1-ylquinazoline |
|---|---|
| PubChem CID | 162490367 |
| Molecular Formula | C37H23N3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 2-[4-[4-(4-isocyanophenyl)phenyl]phenyl]-4-naphthalen-1-ylquinazoline |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3ccc(-c4nc(-c5cccc6ccccc56)c5ccccc5n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H23N3/c1-38-31-23-21-28(22-24-31)26-15-13-25(14-16-26)27-17-19-30(20-18-27)37-39-35-12-5-4-10-34(35)36(40-37)33-11-6-8-29-7-2-3-9-32(29)33/h2-24H |
| InChIKey | WSZFFCKPUXKZNY-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|