C75H48N12 — CID 154597697
5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-carbazol-9-yl-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine (PubChem CID 154597697) has the molecular formula C75H48N12 and a molecular weight of 1117.29 g/mol. Its IUPAC name is 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-carbazol-9-yl-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine.
| Compound Name | 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-carbazol-9-yl-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
|---|---|
| PubChem CID | 154597697 |
| Molecular Formula | C75H48N12 |
| Molecular Weight | 1117.29 g/mol |
| Exact Mass | 1116.41 |
| IUPAC Name | 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-carbazol-9-yl-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N4c5ccccc5N(c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5cc(-n6c7ccccc7c7ccccc76)ccc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C75H48N12/c1-7-25-49(26-8-1)67-76-68(50-27-9-2-10-28-50)79-73(78-67)55-43-45-62(59(47-55)74-81-69(51-29-11-3-12-30-51)77-70(82-74)52-31-13-4-14-32-52)86-63-41-23-24-42-64(63)87(75-83-71(53-33-15-5-16-34-53)80-72(84-75)54-35-17-6-18-36-54)66-48-56(44-46-65(66)86)85-60-39-21-19-37-57(60)58-38-20-22-40-61(58)85/h1-48H |
| InChIKey | VDLDOIFMLVUVLX-UHFFFAOYSA-N |
| XLogP | 17.93 |
| TPSA | 127.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.29 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |