C76H50N10 — CID 154597838
5-[4-(4,6-diphenylpyrimidin-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylphenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine (PubChem CID 154597838) has the molecular formula C76H50N10 and a molecular weight of 1103.31 g/mol. Its IUPAC name is 5-[4-(4,6-diphenylpyrimidin-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylphenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine.
| Compound Name | 5-[4-(4,6-diphenylpyrimidin-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylphenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
|---|---|
| PubChem CID | 154597838 |
| Molecular Formula | C76H50N10 |
| Molecular Weight | 1103.31 g/mol |
| Exact Mass | 1102.42 |
| IUPAC Name | 5-[4-(4,6-diphenylpyrimidin-2-yl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylphenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c(N4c5ccccc5N(c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5ccccc54)c(-c4ccccc4)c3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C76H50N10/c1-9-29-51(30-10-1)61-50-62(52-31-11-2-12-32-52)78-74(77-61)59-49-60(75-81-70(55-37-17-5-18-38-55)79-71(82-75)56-39-19-6-20-40-56)69(68(54-35-15-4-16-36-54)67(59)53-33-13-3-14-34-53)85-63-45-25-27-47-65(63)86(66-48-28-26-46-64(66)85)76-83-72(57-41-21-7-22-42-57)80-73(84-76)58-43-23-8-24-44-58/h1-50H |
| InChIKey | QCOBEBFNPIRSSU-UHFFFAOYSA-N |
| XLogP | 18.77 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1103.31 |
| LogP ≤ 5 | 18.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |