C70H46N10 — CID 154597832
5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine (PubChem CID 154597832) has the molecular formula C70H46N10 and a molecular weight of 1027.21 g/mol. Its IUPAC name is 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine.
| Compound Name | 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine |
|---|---|
| PubChem CID | 154597832 |
| Molecular Formula | C70H46N10 |
| Molecular Weight | 1027.21 g/mol |
| Exact Mass | 1026.39 |
| IUPAC Name | 5-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine |
| SMILES | c1ccc(-c2cc(N3c4ccccc4N(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c(-c5ccccc5)c4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc43)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C70H46N10/c1-8-26-47(27-9-1)55-46-61(72-64(71-55)49-30-12-3-13-31-49)80-58-42-24-22-40-56(58)79(57-41-23-25-43-59(57)80)60-45-44-54(69-75-65(50-32-14-4-15-33-50)73-66(76-69)51-34-16-5-17-35-51)62(48-28-10-2-11-29-48)63(60)70-77-67(52-36-18-6-19-37-52)74-68(78-70)53-38-20-7-21-39-53/h1-46H |
| InChIKey | KFEWIIFSQPVWRP-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.21 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |