C73H49N7 — CID 154597691
5-[2-(4,6-diphenyl-2-pyridinyl)-4-(2,6-diphenylpyrimidin-4-yl)-5-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine (PubChem CID 154597691) has the molecular formula C73H49N7 and a molecular weight of 1024.24 g/mol. Its IUPAC name is 5-[2-(4,6-diphenyl-2-pyridinyl)-4-(2,6-diphenylpyrimidin-4-yl)-5-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine.
| Compound Name | 5-[2-(4,6-diphenyl-2-pyridinyl)-4-(2,6-diphenylpyrimidin-4-yl)-5-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine |
|---|---|
| PubChem CID | 154597691 |
| Molecular Formula | C73H49N7 |
| Molecular Weight | 1024.24 g/mol |
| Exact Mass | 1023.40 |
| IUPAC Name | 5-[2-(4,6-diphenyl-2-pyridinyl)-4-(2,6-diphenylpyrimidin-4-yl)-5-phenylphenyl]-10-(2,6-diphenylpyrimidin-4-yl)phenazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c(-c4ccccc4)cc3N3c4ccccc4N(c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C73H49N7/c1-8-26-50(27-9-1)57-44-61(52-30-12-3-13-31-52)74-64(45-57)60-46-59(65-48-62(53-32-14-4-15-33-53)75-72(77-65)55-36-18-6-19-37-55)58(51-28-10-2-11-29-51)47-70(60)79-66-40-22-24-42-68(66)80(69-43-25-23-41-67(69)79)71-49-63(54-34-16-5-17-35-54)76-73(78-71)56-38-20-7-21-39-56/h1-49H |
| InChIKey | ZGVZIAJZFUVDFL-UHFFFAOYSA-N |
| XLogP | 18.92 |
| TPSA | 70.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.24 |
| LogP ≤ 5 | 18.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |