C36H23N5 — CID 126682761
8-(2,6-diphenylpyrimidin-4-yl)-15-phenyl-8,10,12-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 126682761) has the molecular formula C36H23N5 and a molecular weight of 525.62 g/mol. Its IUPAC name is 8-(2,6-diphenylpyrimidin-4-yl)-15-phenyl-8,10,12-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 8-(2,6-diphenylpyrimidin-4-yl)-15-phenyl-8,10,12-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 126682761 |
| Molecular Formula | C36H23N5 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 8-(2,6-diphenylpyrimidin-4-yl)-15-phenyl-8,10,12-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | c1ccc(-c2cc3c4c(ncnc4c2)N(c2cc(-c4ccccc4)nc(-c4ccccc4)n2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C36H23N5/c1-4-12-24(13-5-1)27-20-29-28-18-10-11-19-32(28)41(36-34(29)31(21-27)37-23-38-36)33-22-30(25-14-6-2-7-15-25)39-35(40-33)26-16-8-3-9-17-26/h1-23H |
| InChIKey | KSSVQRNUWJBQMD-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |