C41H27N5 — CID 129101507
2-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 129101507) has the molecular formula C41H27N5 and a molecular weight of 589.70 g/mol. Its IUPAC name is 2-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 129101507 |
| Molecular Formula | C41H27N5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 2-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C41H27N5/c1-5-16-29(17-6-1)35-27-36(30-18-7-2-8-19-30)43-41(42-35)37-33-24-14-13-15-28(33)25-26-34(37)40-45-38(31-20-9-3-10-21-31)44-39(46-40)32-22-11-4-12-23-32/h1-27H |
| InChIKey | UPOBVCRZEWTODS-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |