C79H63N9 — CID 154597782
5-[3-(3,5-ditert-butylphenyl)-2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine (PubChem CID 154597782) has the molecular formula C79H63N9 and a molecular weight of 1138.44 g/mol. Its IUPAC name is 5-[3-(3,5-ditert-butylphenyl)-2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine.
| Compound Name | 5-[3-(3,5-ditert-butylphenyl)-2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
|---|---|
| PubChem CID | 154597782 |
| Molecular Formula | C79H63N9 |
| Molecular Weight | 1138.44 g/mol |
| Exact Mass | 1137.52 |
| IUPAC Name | 5-[3-(3,5-ditert-butylphenyl)-2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenazine |
| SMILES | CC(C)(C)c1cc(-c2c(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)ccc(N3c4ccccc4N(c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc43)c2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C79H63N9/c1-78(2,3)59-47-58(48-60(49-59)79(4,5)6)71-61(64-50-62(52-29-13-7-14-30-52)80-73(82-64)54-33-17-9-18-34-54)45-46-70(72(71)65-51-63(53-31-15-8-16-32-53)81-74(83-65)55-35-19-10-20-36-55)87-66-41-25-27-43-68(66)88(69-44-28-26-42-67(69)87)77-85-75(56-37-21-11-22-38-56)84-76(86-77)57-39-23-12-24-40-57/h7-51H,1-6H3 |
| InChIKey | OPDNGCAYFXRXNC-UHFFFAOYSA-N |
| XLogP | 20.30 |
| TPSA | 96.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.44 |
| LogP ≤ 5 | 20.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |