C32H33Cl2F2N5O5S — CID 126685461
methyl N-[(1S,2S)-1-(4-chloro-3-fluorophenyl)-1-(5-chloro-3-pyridinyl)-3-[2-[2-(6-ethynyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl)ethyl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate (PubChem CID 126685461) has the molecular formula C32H33Cl2F2N5O5S and a molecular weight of 708.62 g/mol. Its IUPAC name is methyl N-[(1S,2S)-1-(4-chloro-3-fluorophenyl)-1-(5-chloro-3-pyridinyl)-3-[2-[2-(6-ethynyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl)ethyl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[(1S,2S)-1-(4-chloro-3-fluorophenyl)-1-(5-chloro-3-pyridinyl)-3-[2-[2-(6-ethynyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl)ethyl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126685461 |
| Molecular Formula | C32H33Cl2F2N5O5S |
| Molecular Weight | 708.62 g/mol |
| Exact Mass | 707.15 |
| IUPAC Name | methyl N-[(1S,2S)-1-(4-chloro-3-fluorophenyl)-1-(5-chloro-3-pyridinyl)-3-[2-[2-(6-ethynyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl)ethyl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate |
| SMILES | C#CC1CCCS(=O)(=O)NC(CCc2c(F)cccc2NC(=O)[C@@H](NC(=O)OC)C(c2cncc(Cl)c2)c2ccc(Cl)c(F)c2)CN1 |
| InChI | InChI=1S/C32H33Cl2F2N5O5S/c1-3-22-6-5-13-47(44,45)41-23(18-38-22)10-11-24-26(35)7-4-8-28(24)39-31(42)30(40-32(43)46-2)29(20-14-21(33)17-37-16-20)19-9-12-25(34)27(36)15-19/h1,4,7-9,12,14-17,22-23,29-30,38,41H,5-6,10-11,13,18H2,2H3,(H,39,42)(H,40,43)/t22?,23?,29?,30-/m0/s1 |
| InChIKey | HAVHEIREZRHHKN-LDDRXJDWSA-N |
| XLogP | 4.77 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|