C33H46ClFN4O6S — CID 126685233
methyl N-[(1R,2S)-1-(4-chlorophenyl)-1-[(4S)-2,2-dimethyloxan-4-yl]-3-[3-fluoro-2-[2-[(3S)-6-methyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl]ethyl]anilino]-3-oxopropan-2-yl]carbamate (PubChem CID 126685233) has the molecular formula C33H46ClFN4O6S and a molecular weight of 681.27 g/mol. Its IUPAC name is methyl N-[(1R,2S)-1-(4-chlorophenyl)-1-[(4S)-2,2-dimethyloxan-4-yl]-3-[3-fluoro-2-[2-[(3S)-6-methyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl]ethyl]anilino]-3-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[(1R,2S)-1-(4-chlorophenyl)-1-[(4S)-2,2-dimethyloxan-4-yl]-3-[3-fluoro-2-[2-[(3S)-6-methyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl]ethyl]anilino]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126685233 |
| Molecular Formula | C33H46ClFN4O6S |
| Molecular Weight | 681.27 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | methyl N-[(1R,2S)-1-(4-chlorophenyl)-1-[(4S)-2,2-dimethyloxan-4-yl]-3-[3-fluoro-2-[2-[(3S)-6-methyl-1,1-dioxo-1,2,5-thiadiazonan-3-yl]ethyl]anilino]-3-oxopropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)Nc1cccc(F)c1CC[C@H]1CNC(C)CCCS(=O)(=O)N1)[C@@H](c1ccc(Cl)cc1)[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C33H46ClFN4O6S/c1-21-7-6-18-46(42,43)39-25(20-36-21)14-15-26-27(35)8-5-9-28(26)37-31(40)30(38-32(41)44-4)29(22-10-12-24(34)13-11-22)23-16-17-45-33(2,3)19-23/h5,8-13,21,23,25,29-30,36,39H,6-7,14-20H2,1-4H3,(H,37,40)(H,38,41)/t21?,23-,25-,29-,30-/m0/s1 |
| InChIKey | INHLSCZPKABODQ-GRZGLCMJSA-N |
| XLogP | 5.12 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.27 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |