C19H20O6 — CID 126685726
diethyl (4S)-4-(4-ethynylphenyl)-2-hydroxy-3,4-dihydropyran-2,6-dicarboxylate (PubChem CID 126685726) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is diethyl (4S)-4-(4-ethynylphenyl)-2-hydroxy-3,4-dihydropyran-2,6-dicarboxylate.
| Compound Name | diethyl (4S)-4-(4-ethynylphenyl)-2-hydroxy-3,4-dihydropyran-2,6-dicarboxylate |
|---|---|
| PubChem CID | 126685726 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | diethyl (4S)-4-(4-ethynylphenyl)-2-hydroxy-3,4-dihydropyran-2,6-dicarboxylate |
| SMILES | C#Cc1ccc([C@@H]2C=C(C(=O)OCC)OC(O)(C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C19H20O6/c1-4-13-7-9-14(10-8-13)15-11-16(17(20)23-5-2)25-19(22,12-15)18(21)24-6-3/h1,7-11,15,22H,5-6,12H2,2-3H3/t15-,19?/m1/s1 |
| InChIKey | ZECIFLARTLDEJM-NYRJJRHWSA-N |
| XLogP | 1.87 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|