C14H20O2 — CID 126691657
1-cyclopropyloxy-4-(3-methoxypropyl)-2-methylbenzene (PubChem CID 126691657) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-cyclopropyloxy-4-(3-methoxypropyl)-2-methylbenzene.
| Compound Name | 1-cyclopropyloxy-4-(3-methoxypropyl)-2-methylbenzene |
|---|---|
| PubChem CID | 126691657 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-cyclopropyloxy-4-(3-methoxypropyl)-2-methylbenzene |
| SMILES | COCCCc1ccc(OC2CC2)c(C)c1 |
| InChI | InChI=1S/C14H20O2/c1-11-10-12(4-3-9-15-2)5-8-14(11)16-13-6-7-13/h5,8,10,13H,3-4,6-7,9H2,1-2H3 |
| InChIKey | MDXQSQASTOAWOE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|