C25H29ClN2O2 — CID 126698687
N-[(Z)-3-(5-chloro-2-methylphenyl)hept-3-enyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 126698687) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is N-[(Z)-3-(5-chloro-2-methylphenyl)hept-3-enyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[(Z)-3-(5-chloro-2-methylphenyl)hept-3-enyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126698687 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[(Z)-3-(5-chloro-2-methylphenyl)hept-3-enyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CCC/C=C(/CCNC(=O)C1CC(=O)N(c2ccccc2)C1)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C25H29ClN2O2/c1-3-4-8-19(23-16-21(26)12-11-18(23)2)13-14-27-25(30)20-15-24(29)28(17-20)22-9-6-5-7-10-22/h5-12,16,20H,3-4,13-15,17H2,1-2H3,(H,27,30)/b19-8- |
| InChIKey | RQOSDAIORNPFLG-UWVJOHFNSA-N |
| XLogP | 5.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |