C18H22N2O2S2 — CID 126700378
N-[3-(2-aminoethyldisulfanyl)propyl]-4-phenoxybenzamide (PubChem CID 126700378) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[3-(2-aminoethyldisulfanyl)propyl]-4-phenoxybenzamide.
| Compound Name | N-[3-(2-aminoethyldisulfanyl)propyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 126700378 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[3-(2-aminoethyldisulfanyl)propyl]-4-phenoxybenzamide |
| SMILES | NCCSSCCCNC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O2S2/c19-11-14-24-23-13-4-12-20-18(21)15-7-9-17(10-8-15)22-16-5-2-1-3-6-16/h1-3,5-10H,4,11-14,19H2,(H,20,21) |
| InChIKey | QIRZTCBRZRVZJA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|