C22H18Cl2N2O — CID 126702631
N,4-bis(4-chlorophenyl)-1-(4-methoxyphenyl)azetidin-2-imine (PubChem CID 126702631) has the molecular formula C22H18Cl2N2O and a molecular weight of 397.31 g/mol. Its IUPAC name is N,4-bis(4-chlorophenyl)-1-(4-methoxyphenyl)azetidin-2-imine.
| Compound Name | N,4-bis(4-chlorophenyl)-1-(4-methoxyphenyl)azetidin-2-imine |
|---|---|
| PubChem CID | 126702631 |
| Molecular Formula | C22H18Cl2N2O |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N,4-bis(4-chlorophenyl)-1-(4-methoxyphenyl)azetidin-2-imine |
| SMILES | COc1ccc(N2/C(=N/c3ccc(Cl)cc3)CC2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O/c1-27-20-12-10-19(11-13-20)26-21(15-2-4-16(23)5-3-15)14-22(26)25-18-8-6-17(24)7-9-18/h2-13,21H,14H2,1H3/b25-22+ |
| InChIKey | PGTBZRBDSRALFK-YYDJUVGSSA-N |
| XLogP | 6.68 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|