About 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene
1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene (PubChem CID 126702990) has the molecular formula C18H18Cl2F2
and a molecular weight of 343.24 g/mol. Its IUPAC name is 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene |
| PubChem CID | 126702990 |
| Molecular Formula | C18H18Cl2F2 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(Cl)c(C(C)(C)c2ccc(F)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2F2/c1-10(2)11-7-13(19)17(14(20)8-11)18(3,4)12-5-6-15(21)16(22)9-12/h5-10H,1-4H3 |
| InChIKey | MYHSSRRMWHQNEL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene?
The IUPAC name of 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene (CID 126702990) is 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene.
What is the SMILES notation for 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene?
The canonical SMILES for 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene is CC(C)c1cc(Cl)c(C(C)(C)c2ccc(F)c(F)c2)c(Cl)c1.
What is the InChIKey of 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene?
The InChIKey is MYHSSRRMWHQNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2F2/c1-10(2)11-7-13(19)17(14(20)8-11)18(3,4)12-5-6-15(21)16(22)9-12/h5-10H,1-4H3.
What are the key properties of 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene?
1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene has a molecular weight of 343.24 g/mol, XLogP of 6.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-2-[2-(3,4-difluorophenyl)propan-2-yl]-5-propan-2-ylbenzene is sourced from PubChem (CID 126702990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).