C9H15NO3 — CID 126703914
methyl (4R)-3-hydroxy-7-methyl-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 126703914) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl (4R)-3-hydroxy-7-methyl-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (4R)-3-hydroxy-7-methyl-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 126703914 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl (4R)-3-hydroxy-7-methyl-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)C1C(O)[C@H]2CCC1N2C |
| InChI | InChI=1S/C9H15NO3/c1-10-5-3-4-6(10)8(11)7(5)9(12)13-2/h5-8,11H,3-4H2,1-2H3/t5?,6-,7?,8?/m1/s1 |
| InChIKey | HYZGUECXAFEQNL-QQJWGCFSSA-N |
| XLogP | -0.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |