C10H17NO2 — CID 22944649
methyl 8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 22944649) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is methyl 8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 22944649 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | methyl 8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1CCC2CCC1N2C |
| InChI | InChI=1S/C10H17NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h7-9H,3-6H2,1-2H3 |
| InChIKey | DQZOBEGFLQYHHL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |