C10H10F2N3O4P — CID 126704621
[2-(4-amino-3-oxoquinoxalin-2-yl)-1,1-difluoroethyl]phosphonic acid (PubChem CID 126704621) has the molecular formula C10H10F2N3O4P and a molecular weight of 305.18 g/mol. Its IUPAC name is [2-(4-amino-3-oxoquinoxalin-2-yl)-1,1-difluoroethyl]phosphonic acid.
| Compound Name | [2-(4-amino-3-oxoquinoxalin-2-yl)-1,1-difluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 126704621 |
| Molecular Formula | C10H10F2N3O4P |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | [2-(4-amino-3-oxoquinoxalin-2-yl)-1,1-difluoroethyl]phosphonic acid |
| SMILES | Nn1c(=O)c(CC(F)(F)P(=O)(O)O)nc2ccccc21 |
| InChI | InChI=1S/C10H10F2N3O4P/c11-10(12,20(17,18)19)5-7-9(16)15(13)8-4-2-1-3-6(8)14-7/h1-4H,5,13H2,(H2,17,18,19) |
| InChIKey | UZOSDFKAKOALQV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|