C11H7F5N2O2 — CID 43248585
2-[2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-1-yl]acetic acid (PubChem CID 43248585) has the molecular formula C11H7F5N2O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is 2-[2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 43248585 |
| Molecular Formula | C11H7F5N2O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-[2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(C(F)(F)C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C11H7F5N2O2/c12-10(13,11(14,15)16)9-17-6-3-1-2-4-7(6)18(9)5-8(19)20/h1-4H,5H2,(H,19,20) |
| InChIKey | NLIHFSCTFHDBLG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|