C9H5F5N2O — CID 154377012
1-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)benzimidazole (PubChem CID 154377012) has the molecular formula C9H5F5N2O and a molecular weight of 252.14 g/mol. Its IUPAC name is 1-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)benzimidazole.
| Compound Name | 1-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)benzimidazole |
|---|---|
| PubChem CID | 154377012 |
| Molecular Formula | C9H5F5N2O |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)benzimidazole |
| SMILES | On1c(C(F)(F)C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C9H5F5N2O/c10-8(11,9(12,13)14)7-15-5-3-1-2-4-6(5)16(7)17/h1-4,17H |
| InChIKey | KUTGDSFMDQQYEB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|