C13H10N2O3 — CID 136600493
4-(1-hydroxybenzimidazol-2-yl)benzene-1,2-diol (PubChem CID 136600493) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-(1-hydroxybenzimidazol-2-yl)benzene-1,2-diol.
| Compound Name | 4-(1-hydroxybenzimidazol-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 136600493 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-(1-hydroxybenzimidazol-2-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(-c2nc3ccccc3n2O)cc1O |
| InChI | InChI=1S/C13H10N2O3/c16-11-6-5-8(7-12(11)17)13-14-9-3-1-2-4-10(9)15(13)18/h1-7,16-18H |
| InChIKey | GJACOTDMKPJRQY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|