C32H58N2O4S3 — CID 126705849
(NE,4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-N-(4,5,6,7,8-pentaethyl-9-methylundecylidene)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 126705849) has the molecular formula C32H58N2O4S3 and a molecular weight of 631.03 g/mol. Its IUPAC name is (NE,4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-N-(4,5,6,7,8-pentaethyl-9-methylundecylidene)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | (NE,4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-N-(4,5,6,7,8-pentaethyl-9-methylundecylidene)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 126705849 |
| Molecular Formula | C32H58N2O4S3 |
| Molecular Weight | 631.03 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | (NE,4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-N-(4,5,6,7,8-pentaethyl-9-methylundecylidene)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)c2sc(S(=O)(=O)/N=C/CCC(CC)C(CC)C(CC)C(CC)C(CC)C(C)CC)cc21 |
| InChI | InChI=1S/C32H58N2O4S3/c1-10-22(8)25(12-3)27(14-5)28(15-6)26(13-4)24(11-2)18-17-19-34-41(37,38)31-21-29-30(33-16-7)20-23(9)40(35,36)32(29)39-31/h19,21-28,30,33H,10-18,20H2,1-9H3/b34-19+/t22?,23-,24?,25?,26?,27?,28?,30-/m0/s1 |
| InChIKey | JGPWYHHKXHDQAP-HEPXKKPUSA-N |
| XLogP | 8.68 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.03 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|