About methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane
methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane (PubChem CID 126706693) has the molecular formula C13H22NOP
and a molecular weight of 239.30 g/mol. Its IUPAC name is methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane.
Molecular Properties
| Compound Name | methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane |
| PubChem CID | 126706693 |
| Molecular Formula | C13H22NOP |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane |
| SMILES | C=C1/C(=C(\C=C(\C)CC)PC)OCCN1C |
| InChI | InChI=1S/C13H22NOP/c1-6-10(2)9-12(16-5)13-11(3)14(4)7-8-15-13/h9,16H,3,6-8H2,1-2,4-5H3/b10-9-,13-12- |
| InChIKey | UNWARKRXWUXIER-UTJQPWESSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane?
The IUPAC name of methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane (CID 126706693) is methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane.
What is the SMILES notation for methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane?
The canonical SMILES for methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane is C=C1/C(=C(\C=C(\C)CC)PC)OCCN1C.
What is the InChIKey of methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane?
The InChIKey is UNWARKRXWUXIER-UTJQPWESSA-N. The full InChI is InChI=1S/C13H22NOP/c1-6-10(2)9-12(16-5)13-11(3)14(4)7-8-15-13/h9,16H,3,6-8H2,1-2,4-5H3/b10-9-,13-12-.
What are the key properties of methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane?
methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane has a molecular weight of 239.30 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(Z,1Z)-3-methyl-1-(4-methyl-3-methylidenemorpholin-2-ylidene)pent-2-enyl]phosphane is sourced from PubChem (CID 126706693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).