C18H35NO11S2 — CID 126707682
(2S,5R)-2-[(3S,5S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 126707682) has the molecular formula C18H35NO11S2 and a molecular weight of 505.61 g/mol. Its IUPAC name is (2S,5R)-2-[(3S,5S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,5R)-2-[(3S,5S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 126707682 |
| Molecular Formula | C18H35NO11S2 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | (2S,5R)-2-[(3S,5S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CON(CCCSCCS)C1OC(CO)[C@@H](O[C@@H]2OC(CO)[C@H](O)C(O)C2O)C(O)[C@@H]1O |
| InChI | InChI=1S/C18H35NO11S2/c1-27-19(3-2-5-32-6-4-31)17-14(25)13(24)16(10(8-21)28-17)30-18-15(26)12(23)11(22)9(7-20)29-18/h9-18,20-26,31H,2-8H2,1H3/t9?,10?,11-,12?,13?,14-,15?,16+,17?,18-/m0/s1 |
| InChIKey | MJBXABLZOVFYCD-IZJUSVNQSA-N |
| XLogP | -3.47 |
| TPSA | 181.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|