C21H39NO8S2 — CID 126707684
3-cyclohexyl-2-[(3S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-4-yl]oxypropanoic acid (PubChem CID 126707684) has the molecular formula C21H39NO8S2 and a molecular weight of 497.68 g/mol. Its IUPAC name is 3-cyclohexyl-2-[(3S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-4-yl]oxypropanoic acid.
| Compound Name | 3-cyclohexyl-2-[(3S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 126707684 |
| Molecular Formula | C21H39NO8S2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-cyclohexyl-2-[(3S,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]oxan-4-yl]oxypropanoic acid |
| SMILES | CON(CCCSCCS)[C@@H]1OC(CO)[C@H](O)C(OC(CC2CCCCC2)C(=O)O)C1O |
| InChI | InChI=1S/C21H39NO8S2/c1-28-22(8-5-10-32-11-9-31)20-18(25)19(17(24)16(13-23)30-20)29-15(21(26)27)12-14-6-3-2-4-7-14/h14-20,23-25,31H,2-13H2,1H3,(H,26,27)/t15?,16?,17-,18?,19?,20+/m0/s1 |
| InChIKey | WMJAKKMMGRFMBT-IPIVQFTASA-N |
| XLogP | 1.15 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|