C20H37NO13S3 — CID 126707679
(3R,6R)-6-[(3S,6R)-2-ethyl-5-hydroxy-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]-3-methyloxan-4-yl]oxy-3,5-dihydroxy-4-sulfooxyoxane-2-carboxylic acid (PubChem CID 126707679) has the molecular formula C20H37NO13S3 and a molecular weight of 595.71 g/mol. Its IUPAC name is (3R,6R)-6-[(3S,6R)-2-ethyl-5-hydroxy-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]-3-methyloxan-4-yl]oxy-3,5-dihydroxy-4-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (3R,6R)-6-[(3S,6R)-2-ethyl-5-hydroxy-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]-3-methyloxan-4-yl]oxy-3,5-dihydroxy-4-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 126707679 |
| Molecular Formula | C20H37NO13S3 |
| Molecular Weight | 595.71 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | (3R,6R)-6-[(3S,6R)-2-ethyl-5-hydroxy-6-[methoxy-[3-(2-sulfanylethylsulfanyl)propyl]amino]-3-methyloxan-4-yl]oxy-3,5-dihydroxy-4-sulfooxyoxane-2-carboxylic acid |
| SMILES | CCC1O[C@@H](N(CCCSCCS)OC)C(O)C(O[C@@H]2OC(C(=O)O)[C@@H](O)C(OS(=O)(=O)O)C2O)[C@H]1C |
| InChI | InChI=1S/C20H37NO13S3/c1-4-11-10(2)15(13(23)18(31-11)21(30-3)6-5-8-36-9-7-35)32-20-14(24)16(34-37(27,28)29)12(22)17(33-20)19(25)26/h10-18,20,22-24,35H,4-9H2,1-3H3,(H,25,26)(H,27,28,29)/t10-,11?,12-,13?,14?,15?,16?,17?,18+,20+/m0/s1 |
| InChIKey | LBCUIFSZWROUQI-LDGUYYGSSA-N |
| XLogP | -0.86 |
| TPSA | 201.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.71 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|