C33H36F2N4O5 — CID 126707728
N-[(1R,2S)-1-[1-[3-[(cyclopentylamino)-hydroxymethyl]phenyl]indazol-5-yl]oxy-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-yl]-2,2-difluoropropanamide (PubChem CID 126707728) has the molecular formula C33H36F2N4O5 and a molecular weight of 606.67 g/mol. Its IUPAC name is N-[(1R,2S)-1-[1-[3-[(cyclopentylamino)-hydroxymethyl]phenyl]indazol-5-yl]oxy-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-yl]-2,2-difluoropropanamide.
| Compound Name | N-[(1R,2S)-1-[1-[3-[(cyclopentylamino)-hydroxymethyl]phenyl]indazol-5-yl]oxy-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-yl]-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 126707728 |
| Molecular Formula | C33H36F2N4O5 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | N-[(1R,2S)-1-[1-[3-[(cyclopentylamino)-hydroxymethyl]phenyl]indazol-5-yl]oxy-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-yl]-2,2-difluoropropanamide |
| SMILES | C[C@H](NC(=O)C(C)(F)F)[C@H](Oc1ccc2c(cnn2-c2cccc(C(O)NC3CCCC3)c2)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C33H36F2N4O5/c1-20(37-32(41)33(2,34)35)30(21-10-13-28-29(18-21)43-15-14-42-28)44-26-11-12-27-23(17-26)19-36-39(27)25-9-5-6-22(16-25)31(40)38-24-7-3-4-8-24/h5-6,9-13,16-20,24,30-31,38,40H,3-4,7-8,14-15H2,1-2H3,(H,37,41)/t20-,30-,31?/m0/s1 |
| InChIKey | NLKHIZLMNJWURC-UGWDHLALSA-N |
| XLogP | 5.60 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|