C26H24F2N4O3 — CID 57432099
3-[5-[(1R,2S)-2-(2,2-difluoropropanoylamino)-1-phenylpropoxy]indazol-1-yl]benzamide (PubChem CID 57432099) has the molecular formula C26H24F2N4O3 and a molecular weight of 478.50 g/mol. Its IUPAC name is 3-[5-[(1R,2S)-2-(2,2-difluoropropanoylamino)-1-phenylpropoxy]indazol-1-yl]benzamide.
| Compound Name | 3-[5-[(1R,2S)-2-(2,2-difluoropropanoylamino)-1-phenylpropoxy]indazol-1-yl]benzamide |
|---|---|
| PubChem CID | 57432099 |
| Molecular Formula | C26H24F2N4O3 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-[5-[(1R,2S)-2-(2,2-difluoropropanoylamino)-1-phenylpropoxy]indazol-1-yl]benzamide |
| SMILES | C[C@H](NC(=O)C(C)(F)F)[C@H](Oc1ccc2c(cnn2-c2cccc(C(N)=O)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H24F2N4O3/c1-16(31-25(34)26(2,27)28)23(17-7-4-3-5-8-17)35-21-11-12-22-19(14-21)15-30-32(22)20-10-6-9-18(13-20)24(29)33/h3-16,23H,1-2H3,(H2,29,33)(H,31,34)/t16-,23-/m0/s1 |
| InChIKey | RLJOYBDOVUAGRH-HJPURHCSSA-N |
| XLogP | 4.40 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |