C24H19F5N4O2 — CID 156574233
N-[(1R,2S)-1-(3,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)indazol-5-yl]oxypropan-2-yl]-2,2-difluoropropanamide (PubChem CID 156574233) has the molecular formula C24H19F5N4O2 and a molecular weight of 490.43 g/mol. Its IUPAC name is N-[(1R,2S)-1-(3,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)indazol-5-yl]oxypropan-2-yl]-2,2-difluoropropanamide.
| Compound Name | N-[(1R,2S)-1-(3,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)indazol-5-yl]oxypropan-2-yl]-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 156574233 |
| Molecular Formula | C24H19F5N4O2 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[(1R,2S)-1-(3,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)indazol-5-yl]oxypropan-2-yl]-2,2-difluoropropanamide |
| SMILES | C[C@H](NC(=O)C(C)(F)F)[C@H](Oc1ccc2c(cnn2-c2ccc(F)nc2)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H19F5N4O2/c1-13(32-23(34)24(2,28)29)22(14-7-16(25)10-17(26)8-14)35-19-4-5-20-15(9-19)11-31-33(20)18-3-6-21(27)30-12-18/h3-13,22H,1-2H3,(H,32,34)/t13-,22-/m0/s1 |
| InChIKey | QMCLPKWQGXYIEP-XMHCIUCPSA-N |
| XLogP | 5.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|