C17H34O6S — CID 126707966
1-[3-(7-hydroperoxyheptyl)oxiran-2-yl]octane-1-sulfonic acid (PubChem CID 126707966) has the molecular formula C17H34O6S and a molecular weight of 366.52 g/mol. Its IUPAC name is 1-[3-(7-hydroperoxyheptyl)oxiran-2-yl]octane-1-sulfonic acid.
| Compound Name | 1-[3-(7-hydroperoxyheptyl)oxiran-2-yl]octane-1-sulfonic acid |
|---|---|
| PubChem CID | 126707966 |
| Molecular Formula | C17H34O6S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[3-(7-hydroperoxyheptyl)oxiran-2-yl]octane-1-sulfonic acid |
| SMILES | CCCCCCCC(C1OC1CCCCCCCOO)S(=O)(=O)O |
| InChI | InChI=1S/C17H34O6S/c1-2-3-4-6-10-13-16(24(19,20)21)17-15(23-17)12-9-7-5-8-11-14-22-18/h15-18H,2-14H2,1H3,(H,19,20,21) |
| InChIKey | VWAWYISIPQANMR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|