C19H36O6S — CID 88568506
8-methoxy-1-(3-octyloxiran-2-yl)-8-oxooctane-1-sulfonic acid (PubChem CID 88568506) has the molecular formula C19H36O6S and a molecular weight of 392.56 g/mol. Its IUPAC name is 8-methoxy-1-(3-octyloxiran-2-yl)-8-oxooctane-1-sulfonic acid.
| Compound Name | 8-methoxy-1-(3-octyloxiran-2-yl)-8-oxooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 88568506 |
| Molecular Formula | C19H36O6S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 8-methoxy-1-(3-octyloxiran-2-yl)-8-oxooctane-1-sulfonic acid |
| SMILES | CCCCCCCCC1OC1C(CCCCCCC(=O)OC)S(=O)(=O)O |
| InChI | InChI=1S/C19H36O6S/c1-3-4-5-6-7-10-13-16-19(25-16)17(26(21,22)23)14-11-8-9-12-15-18(20)24-2/h16-17,19H,3-15H2,1-2H3,(H,21,22,23) |
| InChIKey | RVBBKZPVKJQHBQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|