C26H29F3N6O — CID 126708251
1-[4-(4-amino-7-propan-2-yl-1,2,3,4-tetrahydropyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-(2,5-difluorophenyl)-3-ethylimidazolidin-2-one (PubChem CID 126708251) has the molecular formula C26H29F3N6O and a molecular weight of 498.55 g/mol. Its IUPAC name is 1-[4-(4-amino-7-propan-2-yl-1,2,3,4-tetrahydropyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-(2,5-difluorophenyl)-3-ethylimidazolidin-2-one.
| Compound Name | 1-[4-(4-amino-7-propan-2-yl-1,2,3,4-tetrahydropyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-(2,5-difluorophenyl)-3-ethylimidazolidin-2-one |
|---|---|
| PubChem CID | 126708251 |
| Molecular Formula | C26H29F3N6O |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1-[4-(4-amino-7-propan-2-yl-1,2,3,4-tetrahydropyrrolo[2,3-d]pyrimidin-5-yl)-3-fluorophenyl]-4-(2,5-difluorophenyl)-3-ethylimidazolidin-2-one |
| SMILES | CCN1C(=O)N(c2ccc(-c3cn(C(C)C)c4c3C(N)NCN4)c(F)c2)CC1c1cc(F)ccc1F |
| InChI | InChI=1S/C26H29F3N6O/c1-4-33-22(18-9-15(27)5-8-20(18)28)12-35(26(33)36)16-6-7-17(21(29)10-16)19-11-34(14(2)3)25-23(19)24(30)31-13-32-25/h5-11,14,22,24,31-32H,4,12-13,30H2,1-3H3 |
| InChIKey | SQSPBZBTRYCUAX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |