C20H17F3N6O — CID 126708803
2-[5-methyl-6-methylimino-3-[2-(trifluoromethyl)phenyl]pyridazin-1-yl]-N-pyrazin-2-ylprop-2-enamide (PubChem CID 126708803) has the molecular formula C20H17F3N6O and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-[5-methyl-6-methylimino-3-[2-(trifluoromethyl)phenyl]pyridazin-1-yl]-N-pyrazin-2-ylprop-2-enamide.
| Compound Name | 2-[5-methyl-6-methylimino-3-[2-(trifluoromethyl)phenyl]pyridazin-1-yl]-N-pyrazin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 126708803 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[5-methyl-6-methylimino-3-[2-(trifluoromethyl)phenyl]pyridazin-1-yl]-N-pyrazin-2-ylprop-2-enamide |
| SMILES | C=C(C(=O)Nc1cnccn1)n1nc(-c2ccccc2C(F)(F)F)cc(C)/c1=N\C |
| InChI | InChI=1S/C20H17F3N6O/c1-12-10-16(14-6-4-5-7-15(14)20(21,22)23)28-29(18(12)24-3)13(2)19(30)27-17-11-25-8-9-26-17/h4-11H,2H2,1,3H3,(H,26,27,30)/b24-18+ |
| InChIKey | MSZFPUYCMZNNSR-HKOYGPOVSA-N |
| XLogP | 3.31 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|