About 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine
5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine (PubChem CID 126709829) has the molecular formula C9H2Cl2F4N4S2
and a molecular weight of 377.18 g/mol. Its IUPAC name is 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine.
Molecular Properties
| Compound Name | 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine |
| PubChem CID | 126709829 |
| Molecular Formula | C9H2Cl2F4N4S2 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine |
| SMILES | Fc1nc(SCSc2nc(F)c(Cl)c(F)n2)nc(F)c1Cl |
| InChI | InChI=1S/C9H2Cl2F4N4S2/c10-2-4(12)16-8(17-5(2)13)20-1-21-9-18-6(14)3(11)7(15)19-9/h1H2 |
| InChIKey | TWORJTFGMNBREG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine?
The IUPAC name of 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine (CID 126709829) is 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine.
What is the SMILES notation for 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine?
The canonical SMILES for 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine is Fc1nc(SCSc2nc(F)c(Cl)c(F)n2)nc(F)c1Cl.
What is the InChIKey of 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine?
The InChIKey is TWORJTFGMNBREG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2Cl2F4N4S2/c10-2-4(12)16-8(17-5(2)13)20-1-21-9-18-6(14)3(11)7(15)19-9/h1H2.
What are the key properties of 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine?
5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine has a molecular weight of 377.18 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(5-chloro-4,6-difluoropyrimidin-2-yl)sulfanylmethylsulfanyl]-4,6-difluoropyrimidine is sourced from PubChem (CID 126709829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).