C5H3ClF2N2S — CID 118554469
5-chloro-4,6-difluoro-2-methylsulfanylpyrimidine (PubChem CID 118554469) has the molecular formula C5H3ClF2N2S and a molecular weight of 196.61 g/mol. Its IUPAC name is 5-chloro-4,6-difluoro-2-methylsulfanylpyrimidine.
| Compound Name | 5-chloro-4,6-difluoro-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 118554469 |
| Molecular Formula | C5H3ClF2N2S |
| Molecular Weight | 196.61 g/mol |
| Exact Mass | 195.97 |
| IUPAC Name | 5-chloro-4,6-difluoro-2-methylsulfanylpyrimidine |
| SMILES | CSc1nc(F)c(Cl)c(F)n1 |
| InChI | InChI=1S/C5H3ClF2N2S/c1-11-5-9-3(7)2(6)4(8)10-5/h1H3 |
| InChIKey | TVEDITORYRTSRB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |