C6H6F2N2S2 — CID 126714725
4,6-difluoro-2,5-bis(methylsulfanyl)pyrimidine (PubChem CID 126714725) has the molecular formula C6H6F2N2S2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4,6-difluoro-2,5-bis(methylsulfanyl)pyrimidine.
| Compound Name | 4,6-difluoro-2,5-bis(methylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 126714725 |
| Molecular Formula | C6H6F2N2S2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 4,6-difluoro-2,5-bis(methylsulfanyl)pyrimidine |
| SMILES | CSc1nc(F)c(SC)c(F)n1 |
| InChI | InChI=1S/C6H6F2N2S2/c1-11-3-4(7)9-6(12-2)10-5(3)8/h1-2H3 |
| InChIKey | JMGSJQRFTWUHCA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |