C6H6ClFN2S2 — CID 123146729
5-chloro-4-fluoro-2,6-bis(methylsulfanyl)pyrimidine (PubChem CID 123146729) has the molecular formula C6H6ClFN2S2 and a molecular weight of 224.71 g/mol. Its IUPAC name is 5-chloro-4-fluoro-2,6-bis(methylsulfanyl)pyrimidine.
| Compound Name | 5-chloro-4-fluoro-2,6-bis(methylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 123146729 |
| Molecular Formula | C6H6ClFN2S2 |
| Molecular Weight | 224.71 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 5-chloro-4-fluoro-2,6-bis(methylsulfanyl)pyrimidine |
| SMILES | CSc1nc(F)c(Cl)c(SC)n1 |
| InChI | InChI=1S/C6H6ClFN2S2/c1-11-5-3(7)4(8)9-6(10-5)12-2/h1-2H3 |
| InChIKey | PJDLKMJOHQMFSX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |