C7H7Cl2FN2S — CID 165439312
4,6-dichloro-5-fluoro-2-propan-2-ylsulfanylpyrimidine (PubChem CID 165439312) has the molecular formula C7H7Cl2FN2S and a molecular weight of 241.12 g/mol. Its IUPAC name is 4,6-dichloro-5-fluoro-2-propan-2-ylsulfanylpyrimidine.
| Compound Name | 4,6-dichloro-5-fluoro-2-propan-2-ylsulfanylpyrimidine |
|---|---|
| PubChem CID | 165439312 |
| Molecular Formula | C7H7Cl2FN2S |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 4,6-dichloro-5-fluoro-2-propan-2-ylsulfanylpyrimidine |
| SMILES | CC(C)Sc1nc(Cl)c(F)c(Cl)n1 |
| InChI | InChI=1S/C7H7Cl2FN2S/c1-3(2)13-7-11-5(8)4(10)6(9)12-7/h3H,1-2H3 |
| InChIKey | MDZUVQZBSNNDQH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |