C5H3Cl2FN2S — CID 155784193
2,4-dichloro-5-fluoro-6-methylsulfanylpyrimidine (PubChem CID 155784193) has the molecular formula C5H3Cl2FN2S and a molecular weight of 213.06 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-6-methylsulfanylpyrimidine.
| Compound Name | 2,4-dichloro-5-fluoro-6-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 155784193 |
| Molecular Formula | C5H3Cl2FN2S |
| Molecular Weight | 213.06 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | 2,4-dichloro-5-fluoro-6-methylsulfanylpyrimidine |
| SMILES | CSc1nc(Cl)nc(Cl)c1F |
| InChI | InChI=1S/C5H3Cl2FN2S/c1-11-4-2(8)3(6)9-5(7)10-4/h1H3 |
| InChIKey | KLWMQGAJXHDIEJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.06 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |