C29H30F5NO2 — CID 126710075
1-[2-[3-(difluoromethyl)phenyl]propyl]-3-[1-(3-nitro-5-propan-2-ylphenyl)propan-2-yl]-5-(trifluoromethyl)benzene (PubChem CID 126710075) has the molecular formula C29H30F5NO2 and a molecular weight of 519.55 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethyl)phenyl]propyl]-3-[1-(3-nitro-5-propan-2-ylphenyl)propan-2-yl]-5-(trifluoromethyl)benzene.
| Compound Name | 1-[2-[3-(difluoromethyl)phenyl]propyl]-3-[1-(3-nitro-5-propan-2-ylphenyl)propan-2-yl]-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 126710075 |
| Molecular Formula | C29H30F5NO2 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-[2-[3-(difluoromethyl)phenyl]propyl]-3-[1-(3-nitro-5-propan-2-ylphenyl)propan-2-yl]-5-(trifluoromethyl)benzene |
| SMILES | CC(C)c1cc(CC(C)c2cc(CC(C)c3cccc(C(F)F)c3)cc(C(F)(F)F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H30F5NO2/c1-17(2)24-10-21(13-27(16-24)35(36)37)9-19(4)25-11-20(12-26(15-25)29(32,33)34)8-18(3)22-6-5-7-23(14-22)28(30)31/h5-7,10-19,28H,8-9H2,1-4H3 |
| InChIKey | RGHWQDVBZUHTOW-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|